C21H16N2O — CID 155516068
2-methyl-3,6-diphenylquinazolin-4-one (PubChem CID 155516068) has the molecular formula C21H16N2O and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-methyl-3,6-diphenylquinazolin-4-one.
| Compound Name | 2-methyl-3,6-diphenylquinazolin-4-one |
|---|---|
| PubChem CID | 155516068 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-methyl-3,6-diphenylquinazolin-4-one |
| SMILES | Cc1nc2ccc(-c3ccccc3)cc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H16N2O/c1-15-22-20-13-12-17(16-8-4-2-5-9-16)14-19(20)21(24)23(15)18-10-6-3-7-11-18/h2-14H,1H3 |
| InChIKey | OGKCLUMQHQHKTQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |