About 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine
2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 155516193) has the molecular formula C21H16N4O2
and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 155516193 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | COc1ccc(-c2cnc3[nH]cc(C#Cc4cccnc4)c3n2)cc1OC |
| InChI | InChI=1S/C21H16N4O2/c1-26-18-8-7-15(10-19(18)27-2)17-13-24-21-20(25-17)16(12-23-21)6-5-14-4-3-9-22-11-14/h3-4,7-13H,1-2H3,(H,23,24) |
| InChIKey | RPJDELGPVRIORQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine (CID 155516193) is 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine is COc1ccc(-c2cnc3[nH]cc(C#Cc4cccnc4)c3n2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is RPJDELGPVRIORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O2/c1-26-18-8-7-15(10-19(18)27-2)17-13-24-21-20(25-17)16(12-23-21)6-5-14-4-3-9-22-11-14/h3-4,7-13H,1-2H3,(H,23,24).
What are the key properties of 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine?
2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 356.39 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-7-(2-pyridin-3-ylethynyl)-5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 155516193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).