C23H26FN3O — CID 155516252
4-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]morpholine (PubChem CID 155516252) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]morpholine.
| Compound Name | 4-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 155516252 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]morpholine |
| SMILES | CC(C)c1ccc(-c2cc(CN3CCOCC3)nn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H26FN3O/c1-17(2)18-3-5-19(6-4-18)23-15-21(16-26-11-13-28-14-12-26)25-27(23)22-9-7-20(24)8-10-22/h3-10,15,17H,11-14,16H2,1-2H3 |
| InChIKey | ZSNIZUIIAPLAOC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |