C32H41N3O — CID 155516301
(E)-N-[5-[4-[[2-(4-methylphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 155516301) has the molecular formula C32H41N3O and a molecular weight of 483.70 g/mol. Its IUPAC name is (E)-N-[5-[4-[[2-(4-methylphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[4-[[2-(4-methylphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 155516301 |
| Molecular Formula | C32H41N3O |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | (E)-N-[5-[4-[[2-(4-methylphenyl)ethyl-propan-2-ylamino]methyl]phenyl]pentyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccc(CCN(Cc2ccc(CCCCCNC(=O)/C=C/c3cccnc3)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C32H41N3O/c1-26(2)35(23-20-29-12-10-27(3)11-13-29)25-31-16-14-28(15-17-31)8-5-4-6-22-34-32(36)19-18-30-9-7-21-33-24-30/h7,9-19,21,24,26H,4-6,8,20,22-23,25H2,1-3H3,(H,34,36)/b19-18+ |
| InChIKey | HDEPWCQIPBWORL-VHEBQXMUSA-N |
| XLogP | 6.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|