C30H35N3O8 — CID 155516353
[(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 1-(4-methoxyphenyl)triazole-4-carboxylate (PubChem CID 155516353) has the molecular formula C30H35N3O8 and a molecular weight of 565.62 g/mol. Its IUPAC name is [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 1-(4-methoxyphenyl)triazole-4-carboxylate.
| Compound Name | [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 1-(4-methoxyphenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 155516353 |
| Molecular Formula | C30H35N3O8 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 1-(4-methoxyphenyl)triazole-4-carboxylate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)c4cn(-c5ccc(OC)cc5)nn4)[C@H]1CC[C@H]2[C@@]12CO[C@]3(O)[C@@H](O)[C@@H]1C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C30H35N3O8/c1-15-18-9-10-20-28-14-40-30(38,24(36)22(28)27(2,3)12-11-21(28)34)29(20,23(15)35)25(18)41-26(37)19-13-33(32-31-19)16-5-7-17(39-4)8-6-16/h5-8,13,18,20-22,24-25,34,36,38H,1,9-12,14H2,2-4H3/t18-,20-,21-,22+,24-,25+,28+,29-,30+/m0/s1 |
| InChIKey | HJFAGGZZQIDXEA-RVPZNXJBSA-N |
| XLogP | 1.83 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|