C25H39N3Si — CID 155516584
1-[[1-cyclohexyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane (PubChem CID 155516584) has the molecular formula C25H39N3Si and a molecular weight of 409.69 g/mol. Its IUPAC name is 1-[[1-cyclohexyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane.
| Compound Name | 1-[[1-cyclohexyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
|---|---|
| PubChem CID | 155516584 |
| Molecular Formula | C25H39N3Si |
| Molecular Weight | 409.69 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | 1-[[1-cyclohexyl-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
| SMILES | CC(C)c1ccc(-c2cc(CN3CC[Si](C)(C)CC3)nn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H39N3Si/c1-20(2)21-10-12-22(13-11-21)25-18-23(19-27-14-16-29(3,4)17-15-27)26-28(25)24-8-6-5-7-9-24/h10-13,18,20,24H,5-9,14-17,19H2,1-4H3 |
| InChIKey | NRNAVAWDIFEDCC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|