About [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate
[(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate (PubChem CID 155516615) has the molecular formula C16H16O5
and a molecular weight of 288.30 g/mol. Its IUPAC name is [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate |
| PubChem CID | 155516615 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1C=CC=C(COC(=O)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C16H16O5/c1-11(17)21-14-9-5-8-13(15(14)18)10-20-16(19)12-6-3-2-4-7-12/h2-9,14-15,18H,10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | LLUDVSKOGAFREF-GJZGRUSLSA-N |
| XLogP | 1.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate?
The IUPAC name of [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate (CID 155516615) is [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate.
What is the SMILES notation for [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate?
The canonical SMILES for [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate is CC(=O)O[C@H]1C=CC=C(COC(=O)c2ccccc2)[C@@H]1O.
What is the InChIKey of [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate?
The InChIKey is LLUDVSKOGAFREF-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H16O5/c1-11(17)21-14-9-5-8-13(15(14)18)10-20-16(19)12-6-3-2-4-7-12/h2-9,14-15,18H,10H2,1H3/t14-,15-/m0/s1.
What are the key properties of [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate?
[(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate has a molecular weight of 288.30 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S,6S)-5-acetyloxy-6-hydroxycyclohexa-1,3-dien-1-yl]methyl benzoate is sourced from PubChem (CID 155516615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).