C24H38O5 — CID 155516720
(2Z,4E)-2-[(Z)-2-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]prop-1-enyl]hepta-2,4-dienedioic acid (PubChem CID 155516720) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is (2Z,4E)-2-[(Z)-2-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]prop-1-enyl]hepta-2,4-dienedioic acid.
| Compound Name | (2Z,4E)-2-[(Z)-2-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]prop-1-enyl]hepta-2,4-dienedioic acid |
|---|---|
| PubChem CID | 155516720 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | (2Z,4E)-2-[(Z)-2-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]prop-1-enyl]hepta-2,4-dienedioic acid |
| SMILES | CC[C@H](C)C[C@H](C)C[C@@H]1CO[C@@H](/C(C)=C\C(=C\C=C\CC(=O)O)C(=O)O)[C@H](C)C1 |
| InChI | InChI=1S/C24H38O5/c1-6-16(2)11-17(3)12-20-13-18(4)23(29-15-20)19(5)14-21(24(27)28)9-7-8-10-22(25)26/h7-9,14,16-18,20,23H,6,10-13,15H2,1-5H3,(H,25,26)(H,27,28)/b8-7+,19-14-,21-9-/t16-,17-,18+,20-,23+/m0/s1 |
| InChIKey | DGSITCBUNUVDBA-QCCVYROPSA-N |
| XLogP | 5.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|