About N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide
N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide (PubChem CID 155516721) has the molecular formula C26H23ClN2O7
and a molecular weight of 510.93 g/mol. Its IUPAC name is N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide |
| PubChem CID | 155516721 |
| Molecular Formula | C26H23ClN2O7 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)c2[nH]c3cc(Cl)ccc3c2NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C26H23ClN2O7/c1-33-19-8-5-13(9-18(19)30)24(31)23-22(16-7-6-15(27)12-17(16)28-23)29-26(32)14-10-20(34-2)25(36-4)21(11-14)35-3/h5-12,28,30H,1-4H3,(H,29,32) |
| InChIKey | LGTZAUXVUBADHQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide?
The IUPAC name of N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide (CID 155516721) is N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide.
What is the SMILES notation for N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide?
The canonical SMILES for N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide is COc1ccc(C(=O)c2[nH]c3cc(Cl)ccc3c2NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1O.
What is the InChIKey of N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide?
The InChIKey is LGTZAUXVUBADHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23ClN2O7/c1-33-19-8-5-13(9-18(19)30)24(31)23-22(16-7-6-15(27)12-17(16)28-23)29-26(32)14-10-20(34-2)25(36-4)21(11-14)35-3/h5-12,28,30H,1-4H3,(H,29,32).
What are the key properties of N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide?
N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide has a molecular weight of 510.93 g/mol, XLogP of 5.04, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-chloro-2-(3-hydroxy-4-methoxybenzoyl)-1H-indol-3-yl]-3,4,5-trimethoxybenzamide is sourced from PubChem (CID 155516721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).