About methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate
methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate (PubChem CID 155516816) has the molecular formula C14H11ClN4O3S2
and a molecular weight of 382.85 g/mol. Its IUPAC name is methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate |
| PubChem CID | 155516816 |
| Molecular Formula | C14H11ClN4O3S2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc2nc(SCC(=O)Nc3nccs3)[nH]c2cc1Cl |
| InChI | InChI=1S/C14H11ClN4O3S2/c1-22-12(21)7-4-9-10(5-8(7)15)18-14(17-9)24-6-11(20)19-13-16-2-3-23-13/h2-5H,6H2,1H3,(H,17,18)(H,16,19,20) |
| InChIKey | IWJYZFJSMPUOPG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate?
The IUPAC name of methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate (CID 155516816) is methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate.
What is the SMILES notation for methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate?
The canonical SMILES for methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate is COC(=O)c1cc2nc(SCC(=O)Nc3nccs3)[nH]c2cc1Cl.
What is the InChIKey of methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate?
The InChIKey is IWJYZFJSMPUOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN4O3S2/c1-22-12(21)7-4-9-10(5-8(7)15)18-14(17-9)24-6-11(20)19-13-16-2-3-23-13/h2-5H,6H2,1H3,(H,17,18)(H,16,19,20).
What are the key properties of methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate?
methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate has a molecular weight of 382.85 g/mol, XLogP of 3.19, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-2-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1H-benzimidazole-5-carboxylate is sourced from PubChem (CID 155516816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).