C36H48ClN7O — CID 155516849
N-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 155516849) has the molecular formula C36H48ClN7O and a molecular weight of 630.28 g/mol. Its IUPAC name is N-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 155516849 |
| Molecular Formula | C36H48ClN7O |
| Molecular Weight | 630.28 g/mol |
| Exact Mass | 629.36 |
| IUPAC Name | N-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-4-(cyclohexylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC3CCCCC3)c(C(=O)NCCCCCCCCNc3c4c(nc5cc(Cl)ccc35)CCCC4)cnc21 |
| InChI | InChI=1S/C36H48ClN7O/c1-2-44-35-29(24-41-44)34(42-26-14-8-7-9-15-26)30(23-40-35)36(45)39-21-13-6-4-3-5-12-20-38-33-27-16-10-11-17-31(27)43-32-22-25(37)18-19-28(32)33/h18-19,22-24,26H,2-17,20-21H2,1H3,(H,38,43)(H,39,45)(H,40,42) |
| InChIKey | DIWOJIVCVPQWMA-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.28 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|