C20H21BrFN7O4S — CID 155516857
4-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155516857) has the molecular formula C20H21BrFN7O4S and a molecular weight of 554.40 g/mol. Its IUPAC name is 4-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155516857 |
| Molecular Formula | C20H21BrFN7O4S |
| Molecular Weight | 554.40 g/mol |
| Exact Mass | 553.05 |
| IUPAC Name | 4-[2-(5-benzyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S1(=O)N(CCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H21BrFN7O4S/c21-16-12-15(6-7-17(16)22)24-20(25-30)18-19(27-33-26-18)23-8-9-28-10-11-29(34(28,31)32)13-14-4-2-1-3-5-14/h1-7,12,30H,8-11,13H2,(H,23,27)(H,24,25) |
| InChIKey | YXMMXOREAIHFHQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|