About 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol
2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol (PubChem CID 155516858) has the molecular formula C24H16ClNO2
and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol |
| PubChem CID | 155516858 |
| Molecular Formula | C24H16ClNO2 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol |
| SMILES | Oc1cccc(-c2cc(-c3cccc(Cl)c3)nc3c2Cc2cc(O)ccc2-3)c1 |
| InChI | InChI=1S/C24H16ClNO2/c25-17-5-1-4-15(9-17)23-13-21(14-3-2-6-18(27)10-14)22-12-16-11-19(28)7-8-20(16)24(22)26-23/h1-11,13,27-28H,12H2 |
| InChIKey | GVKQNSBQFGMEMX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol?
The IUPAC name of 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol (CID 155516858) is 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol.
What is the SMILES notation for 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol?
The canonical SMILES for 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol is Oc1cccc(-c2cc(-c3cccc(Cl)c3)nc3c2Cc2cc(O)ccc2-3)c1.
What is the InChIKey of 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol?
The InChIKey is GVKQNSBQFGMEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16ClNO2/c25-17-5-1-4-15(9-17)23-13-21(14-3-2-6-18(27)10-14)22-12-16-11-19(28)7-8-20(16)24(22)26-23/h1-11,13,27-28H,12H2.
What are the key properties of 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol?
2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol has a molecular weight of 385.85 g/mol, XLogP of 6.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-4-(3-hydroxyphenyl)-5H-indeno[1,2-b]pyridin-7-ol is sourced from PubChem (CID 155516858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).