C17H16N2O3 — CID 155517161
(1E,3E,6E,8E)-1,9-bis(5-methyl-1,2-oxazol-3-yl)nona-1,3,6,8-tetraen-5-one (PubChem CID 155517161) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (1E,3E,6E,8E)-1,9-bis(5-methyl-1,2-oxazol-3-yl)nona-1,3,6,8-tetraen-5-one.
| Compound Name | (1E,3E,6E,8E)-1,9-bis(5-methyl-1,2-oxazol-3-yl)nona-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 155517161 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1E,3E,6E,8E)-1,9-bis(5-methyl-1,2-oxazol-3-yl)nona-1,3,6,8-tetraen-5-one |
| SMILES | Cc1cc(/C=C/C=C/C(=O)/C=C/C=C/c2cc(C)on2)no1 |
| InChI | InChI=1S/C17H16N2O3/c1-13-11-15(18-21-13)7-3-5-9-17(20)10-6-4-8-16-12-14(2)22-19-16/h3-12H,1-2H3/b7-3+,8-4+,9-5+,10-6+ |
| InChIKey | LKIXMJGVDXXEIW-JMFUVXGRSA-N |
| XLogP | 3.69 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|