About 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol
1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol (PubChem CID 155517345) has the molecular formula C25H24Br2N2O2
and a molecular weight of 544.29 g/mol. Its IUPAC name is 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol.
Molecular Properties
| Compound Name | 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol |
| PubChem CID | 155517345 |
| Molecular Formula | C25H24Br2N2O2 |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol |
| SMILES | OC(CNCc1cccc(OCc2ccccc2)c1)Cn1cc(Br)c2cc(Br)ccc21 |
| InChI | InChI=1S/C25H24Br2N2O2/c26-20-9-10-25-23(12-20)24(27)16-29(25)15-21(30)14-28-13-19-7-4-8-22(11-19)31-17-18-5-2-1-3-6-18/h1-12,16,21,28,30H,13-15,17H2 |
| InChIKey | DETGCLIOJUVWEZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol?
The IUPAC name of 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol (CID 155517345) is 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol.
What is the SMILES notation for 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol?
The canonical SMILES for 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol is OC(CNCc1cccc(OCc2ccccc2)c1)Cn1cc(Br)c2cc(Br)ccc21.
What is the InChIKey of 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol?
The InChIKey is DETGCLIOJUVWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24Br2N2O2/c26-20-9-10-25-23(12-20)24(27)16-29(25)15-21(30)14-28-13-19-7-4-8-22(11-19)31-17-18-5-2-1-3-6-18/h1-12,16,21,28,30H,13-15,17H2.
What are the key properties of 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol?
1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol has a molecular weight of 544.29 g/mol, XLogP of 5.90, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dibromoindol-1-yl)-3-[(3-phenylmethoxyphenyl)methylamino]propan-2-ol is sourced from PubChem (CID 155517345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).