C32H34FNO12 — CID 155517359
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[1-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate (PubChem CID 155517359) has the molecular formula C32H34FNO12 and a molecular weight of 643.62 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[1-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[1-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155517359 |
| Molecular Formula | C32H34FNO12 |
| Molecular Weight | 643.62 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[3-[1-[(4-fluorophenyl)methyl]-3-hydroxy-2-oxoindol-3-yl]-2-oxopropyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CC(=O)CC2(O)C(=O)N(Cc3ccc(F)cc3)c3ccccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H34FNO12/c1-17(35)42-16-27-29(44-19(3)37)30(45-20(4)38)28(43-18(2)36)26(46-27)13-23(39)14-32(41)24-7-5-6-8-25(24)34(31(32)40)15-21-9-11-22(33)12-10-21/h5-12,26-30,41H,13-16H2,1-4H3/t26-,27+,28-,29+,30+,32?/m0/s1 |
| InChIKey | WYBDDJCRTSJCLX-RIEUMJKJSA-N |
| XLogP | 2.04 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|