About 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine
5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine (PubChem CID 155517408) has the molecular formula C15H17NO2S
and a molecular weight of 275.37 g/mol. Its IUPAC name is 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine |
| PubChem CID | 155517408 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine |
| SMILES | c1cc2cc(C3COC4(CCCCC4)O3)ncc2s1 |
| InChI | InChI=1S/C15H17NO2S/c1-2-5-15(6-3-1)17-10-13(18-15)12-8-11-4-7-19-14(11)9-16-12/h4,7-9,13H,1-3,5-6,10H2 |
| InChIKey | PIUKXEZOPHRQKS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine?
The IUPAC name of 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine (CID 155517408) is 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine.
What is the SMILES notation for 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine?
The canonical SMILES for 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine is c1cc2cc(C3COC4(CCCCC4)O3)ncc2s1.
What is the InChIKey of 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine?
The InChIKey is PIUKXEZOPHRQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2S/c1-2-5-15(6-3-1)17-10-13(18-15)12-8-11-4-7-19-14(11)9-16-12/h4,7-9,13H,1-3,5-6,10H2.
What are the key properties of 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine?
5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine has a molecular weight of 275.37 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-dioxaspiro[4.5]decan-3-yl)thieno[2,3-c]pyridine is sourced from PubChem (CID 155517408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).