About [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine
[5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine (PubChem CID 155517450) has the molecular formula C11H19N3O4S3
and a molecular weight of 353.49 g/mol. Its IUPAC name is [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine |
| PubChem CID | 155517450 |
| Molecular Formula | C11H19N3O4S3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine |
| SMILES | CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(CN)s2)CC1 |
| InChI | InChI=1S/C11H19N3O4S3/c1-20(15,16)13-5-2-6-14(8-7-13)21(17,18)11-4-3-10(9-12)19-11/h3-4H,2,5-9,12H2,1H3 |
| InChIKey | HZTCITRXLSPCPW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine?
The IUPAC name of [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine (CID 155517450) is [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine.
What is the SMILES notation for [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine?
The canonical SMILES for [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine is CS(=O)(=O)N1CCCN(S(=O)(=O)c2ccc(CN)s2)CC1.
What is the InChIKey of [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine?
The InChIKey is HZTCITRXLSPCPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O4S3/c1-20(15,16)13-5-2-6-14(8-7-13)21(17,18)11-4-3-10(9-12)19-11/h3-4H,2,5-9,12H2,1H3.
What are the key properties of [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine?
[5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine has a molecular weight of 353.49 g/mol, XLogP of -0.14, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(4-methylsulfonyl-1,4-diazepan-1-yl)sulfonyl]thiophen-2-yl]methanamine is sourced from PubChem (CID 155517450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).