C26H25F2N5O6S — CID 155517457
5-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxy-N-hydroxypentanamide (PubChem CID 155517457) has the molecular formula C26H25F2N5O6S and a molecular weight of 573.58 g/mol. Its IUPAC name is 5-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxy-N-hydroxypentanamide.
| Compound Name | 5-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxy-N-hydroxypentanamide |
|---|---|
| PubChem CID | 155517457 |
| Molecular Formula | C26H25F2N5O6S |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 5-[6-[5-[(2,4-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]-4-methylquinazolin-8-yl]oxy-N-hydroxypentanamide |
| SMILES | COc1ncc(-c2cc(OCCCCC(=O)NO)c3ncnc(C)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C26H25F2N5O6S/c1-15-19-9-16(11-22(25(19)31-14-30-15)39-8-4-3-5-24(34)32-35)17-10-21(26(38-2)29-13-17)33-40(36,37)23-7-6-18(27)12-20(23)28/h6-7,9-14,33,35H,3-5,8H2,1-2H3,(H,32,34) |
| InChIKey | ZHVCBNVDQBAPFE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|