About N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide
N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide (PubChem CID 155517471) has the molecular formula C25H18N4O
and a molecular weight of 390.45 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide.
Molecular Properties
| Compound Name | N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide |
| PubChem CID | 155517471 |
| Molecular Formula | C25H18N4O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cc2c3ccccc3[nH]c2c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C25H18N4O/c30-25(27-14-15-9-11-26-12-10-15)19-13-18-16-5-1-3-7-20(16)28-23(18)22-17-6-2-4-8-21(17)29-24(19)22/h1-13,28-29H,14H2,(H,27,30) |
| InChIKey | GUDDTKJBDCPMKF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
The IUPAC name of N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide (CID 155517471) is N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide.
What is the SMILES notation for N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
The canonical SMILES for N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide is O=C(NCc1ccncc1)c1cc2c3ccccc3[nH]c2c2c1[nH]c1ccccc12.
What is the InChIKey of N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
The InChIKey is GUDDTKJBDCPMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N4O/c30-25(27-14-15-9-11-26-12-10-15)19-13-18-16-5-1-3-7-20(16)28-23(18)22-17-6-2-4-8-21(17)29-24(19)22/h1-13,28-29H,14H2,(H,27,30).
What are the key properties of N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide?
N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide has a molecular weight of 390.45 g/mol, XLogP of 5.28, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(pyridin-4-ylmethyl)-5,12-dihydroindolo[3,2-c]carbazole-6-carboxamide is sourced from PubChem (CID 155517471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).