About 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide
1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 155517524) has the molecular formula C27H19N5O2
and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 155517524 |
| Molecular Formula | C27H19N5O2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1cc2c([nH]c3ccccc32)c(C(=O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C27H19N5O2/c33-26(20-15-29-21-9-3-1-8-18(20)21)25-24-19(17-7-2-4-10-22(17)31-24)12-23(32-25)27(34)30-14-16-6-5-11-28-13-16/h1-13,15,29,31H,14H2,(H,30,34) |
| InChIKey | IYOYSJYXGDKXAV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide (CID 155517524) is 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide is O=C(NCc1cccnc1)c1cc2c([nH]c3ccccc32)c(C(=O)c2c[nH]c3ccccc23)n1.
What is the InChIKey of 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is IYOYSJYXGDKXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19N5O2/c33-26(20-15-29-21-9-3-1-8-18(20)21)25-24-19(17-7-2-4-10-22(17)31-24)12-23(32-25)27(34)30-14-16-6-5-11-28-13-16/h1-13,15,29,31H,14H2,(H,30,34).
What are the key properties of 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide?
1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 445.48 g/mol, XLogP of 4.75, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-indole-3-carbonyl)-N-(pyridin-3-ylmethyl)-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 155517524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).