C36H45N7O5 — CID 155517555
N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide (PubChem CID 155517555) has the molecular formula C36H45N7O5 and a molecular weight of 655.80 g/mol. Its IUPAC name is N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 155517555 |
| Molecular Formula | C36H45N7O5 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-6,7-dimethoxyquinazolin-2-yl]amino]phenyl]-N'-hydroxyoctanediamide |
| SMILES | COc1cc2nc(Nc3ccc(NC(=O)CCCCCCC(=O)NO)cc3)nc(NC3CCN(Cc4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C36H45N7O5/c1-47-31-22-29-30(23-32(31)48-2)40-36(41-35(29)38-28-18-20-43(21-19-28)24-25-10-6-5-7-11-25)39-27-16-14-26(15-17-27)37-33(44)12-8-3-4-9-13-34(45)42-46/h5-7,10-11,14-17,22-23,28,46H,3-4,8-9,12-13,18-21,24H2,1-2H3,(H,37,44)(H,42,45)(H2,38,39,40,41) |
| InChIKey | WEPAKBVXIDUBTA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 149.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|