C18H26O4 — CID 155517562
(1R,5S,6R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6,9-dihydroxy-2-oxaspiro[4.5]dec-7-en-3-one (PubChem CID 155517562) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (1R,5S,6R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6,9-dihydroxy-2-oxaspiro[4.5]dec-7-en-3-one.
| Compound Name | (1R,5S,6R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6,9-dihydroxy-2-oxaspiro[4.5]dec-7-en-3-one |
|---|---|
| PubChem CID | 155517562 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (1R,5S,6R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-6,9-dihydroxy-2-oxaspiro[4.5]dec-7-en-3-one |
| SMILES | CC(C)=CCC/C(C)=C/[C@H]1OC(=O)C[C@]12C[C@H](O)C=C[C@H]2O |
| InChI | InChI=1S/C18H26O4/c1-12(2)5-4-6-13(3)9-16-18(11-17(21)22-16)10-14(19)7-8-15(18)20/h5,7-9,14-16,19-20H,4,6,10-11H2,1-3H3/b13-9+/t14-,15-,16-,18+/m1/s1 |
| InChIKey | AYHRHYMQFCEWFL-FZIVYQPVSA-N |
| XLogP | 2.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|