C31H31ClN4O4S — CID 155517595
1-(1,3-benzothiazol-2-yl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]hydrazine chloride (PubChem CID 155517595) has the molecular formula C31H31ClN4O4S and a molecular weight of 591.13 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]hydrazine chloride.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]hydrazine chloride |
|---|---|
| PubChem CID | 155517595 |
| Molecular Formula | C31H31ClN4O4S |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]hydrazine chloride |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCCCNNc1nc2ccccc2s1)CCc1cc2c(cc1-3)OCO2.[Cl-] |
| InChI | InChI=1S/C31H31N4O4S.ClH/c1-36-26-10-9-20-15-25-22-17-28-27(38-19-39-28)16-21(22)11-13-35(25)18-23(20)30(26)37-14-6-2-5-12-32-34-31-33-24-7-3-4-8-29(24)40-31;/h3-4,7-10,15-18,32H,2,5-6,11-14,19H2,1H3,(H,33,34);1H/q+1;/p-1 |
| InChIKey | NWBWSTVAVTVUFJ-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|