C28H36Cl2N2O — CID 155517617
1-phenyl-4-[[4-[2-(4-propan-2-ylphenoxy)ethyl]phenyl]methyl]piperazine;dihydrochloride (PubChem CID 155517617) has the molecular formula C28H36Cl2N2O and a molecular weight of 487.52 g/mol. Its IUPAC name is 1-phenyl-4-[[4-[2-(4-propan-2-ylphenoxy)ethyl]phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-phenyl-4-[[4-[2-(4-propan-2-ylphenoxy)ethyl]phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 155517617 |
| Molecular Formula | C28H36Cl2N2O |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 1-phenyl-4-[[4-[2-(4-propan-2-ylphenoxy)ethyl]phenyl]methyl]piperazine;dihydrochloride |
| SMILES | CC(C)c1ccc(OCCc2ccc(CN3CCN(c4ccccc4)CC3)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C28H34N2O.2ClH/c1-23(2)26-12-14-28(15-13-26)31-21-16-24-8-10-25(11-9-24)22-29-17-19-30(20-18-29)27-6-4-3-5-7-27;;/h3-15,23H,16-22H2,1-2H3;2*1H |
| InChIKey | ATZJTNPBYBALHX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |