C31H33Cl2N3O5 — CID 155517686
6-chloro-N-(2-chlorophenyl)-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 155517686) has the molecular formula C31H33Cl2N3O5 and a molecular weight of 598.53 g/mol. Its IUPAC name is 6-chloro-N-(2-chlorophenyl)-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 6-chloro-N-(2-chlorophenyl)-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 155517686 |
| Molecular Formula | C31H33Cl2N3O5 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | 6-chloro-N-(2-chlorophenyl)-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | COCCOCCOCCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C31H33Cl2N3O5/c1-38-14-15-39-16-17-40-18-19-41-23-9-6-21(7-10-23)30-29-24(25-20-22(32)8-11-27(25)34-29)12-13-36(30)31(37)35-28-5-3-2-4-26(28)33/h2-11,20,30,34H,12-19H2,1H3,(H,35,37) |
| InChIKey | ITNQOIYUHQFJAH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|