C18H33N3O3 — CID 155517710
N-[[(3S,4S)-3-butyl-3-methoxy-6,6-dimethyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 155517710) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[[(3S,4S)-3-butyl-3-methoxy-6,6-dimethyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[(3S,4S)-3-butyl-3-methoxy-6,6-dimethyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 155517710 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | N-[[(3S,4S)-3-butyl-3-methoxy-6,6-dimethyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | CCCC[C@]1(OC)OOC(C)(C)C[C@H]1CNCCCn1ccnc1 |
| InChI | InChI=1S/C18H33N3O3/c1-5-6-8-18(22-4)16(13-17(2,3)23-24-18)14-19-9-7-11-21-12-10-20-15-21/h10,12,15-16,19H,5-9,11,13-14H2,1-4H3/t16-,18-/m0/s1 |
| InChIKey | PWCOZJCWSXMSOC-WMZOPIPTSA-N |
| XLogP | 3.14 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|