C34H38F3N3O4 — CID 15551778
9-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 15551778) has the molecular formula C34H38F3N3O4 and a molecular weight of 609.69 g/mol. Its IUPAC name is 9-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 15551778 |
| Molecular Formula | C34H38F3N3O4 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | 9-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | COc1ccc(CC(=O)N2CCN(CCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)CC2)cc1OC |
| InChI | InChI=1S/C34H38F3N3O4/c1-43-29-14-13-24(21-30(29)44-2)22-31(41)40-19-17-39(18-20-40)16-8-7-15-33(32(42)38-23-34(35,36)37)27-11-5-3-9-25(27)26-10-4-6-12-28(26)33/h3-6,9-14,21H,7-8,15-20,22-23H2,1-2H3,(H,38,42) |
| InChIKey | CUPGAQXTCPTSGF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|