C36H49N7O — CID 155517795
4-(cyclohexylamino)-1-ethyl-N-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyl]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 155517795) has the molecular formula C36H49N7O and a molecular weight of 595.84 g/mol. Its IUPAC name is 4-(cyclohexylamino)-1-ethyl-N-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyl]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-(cyclohexylamino)-1-ethyl-N-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 155517795 |
| Molecular Formula | C36H49N7O |
| Molecular Weight | 595.84 g/mol |
| Exact Mass | 595.40 |
| IUPAC Name | 4-(cyclohexylamino)-1-ethyl-N-[8-(1,2,3,4-tetrahydroacridin-9-ylamino)octyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC3CCCCC3)c(C(=O)NCCCCCCCCNc3c4c(nc5ccccc35)CCCC4)cnc21 |
| InChI | InChI=1S/C36H49N7O/c1-2-43-35-29(25-40-43)34(41-26-16-8-7-9-17-26)30(24-39-35)36(44)38-23-15-6-4-3-5-14-22-37-33-27-18-10-12-20-31(27)42-32-21-13-11-19-28(32)33/h10,12,18,20,24-26H,2-9,11,13-17,19,21-23H2,1H3,(H,37,42)(H,38,44)(H,39,41) |
| InChIKey | QDLFZSXYMYOCBX-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.84 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|