About 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine
1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine (PubChem CID 155517835) has the molecular formula C19H18FN5
and a molecular weight of 335.39 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine |
| PubChem CID | 155517835 |
| Molecular Formula | C19H18FN5 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccn2c(-c3cn[nH]c3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C19H18FN5/c1-24(2)12-13-7-8-25-17(9-13)23-18(14-3-5-16(20)6-4-14)19(25)15-10-21-22-11-15/h3-11H,12H2,1-2H3,(H,21,22) |
| InChIKey | MKAZDNJZZNPECQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine (CID 155517835) is 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine is CN(C)Cc1ccn2c(-c3cn[nH]c3)c(-c3ccc(F)cc3)nc2c1.
What is the InChIKey of 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine?
The InChIKey is MKAZDNJZZNPECQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN5/c1-24(2)12-13-7-8-25-17(9-13)23-18(14-3-5-16(20)6-4-14)19(25)15-10-21-22-11-15/h3-11H,12H2,1-2H3,(H,21,22).
What are the key properties of 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine?
1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine has a molecular weight of 335.39 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-fluorophenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-7-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 155517835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).