C18H27F6N7O4 — CID 155517879
2-[(3R)-1-[2-(2,2-dimethylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]guanidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155517879) has the molecular formula C18H27F6N7O4 and a molecular weight of 519.45 g/mol. Its IUPAC name is 2-[(3R)-1-[2-(2,2-dimethylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]guanidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(3R)-1-[2-(2,2-dimethylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]guanidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155517879 |
| Molecular Formula | C18H27F6N7O4 |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-[(3R)-1-[2-(2,2-dimethylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]guanidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)(C)CNc1nccc(N2CC[C@@H](N=C(N)N)C2)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H25N7.2C2HF3O2/c1-14(2,3)9-18-13-17-6-4-11(20-13)21-7-5-10(8-21)19-12(15)16;2*3-2(4,5)1(6)7/h4,6,10H,5,7-9H2,1-3H3,(H4,15,16,19)(H,17,18,20);2*(H,6,7)/t10-;;/m1../s1 |
| InChIKey | CXPRLKXVJXKVJM-YQFADDPSSA-N |
| XLogP | 2.05 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|