About CID 155517892
CID 155517892 (PubChem CID 155517892) has the molecular formula C27H30BrN6O4
and a molecular weight of 582.48 g/mol.
Molecular Properties
| Compound Name | CID 155517892 |
| PubChem CID | 155517892 |
| Molecular Formula | C27H30BrN6O4 |
| Molecular Weight | 582.48 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Nc3nc(Nc4ccc(C(=O)O)cc4)ncc3Br)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C27H30BrN6O4/c1-26(2)13-20(14-27(3,4)34(26)38)31-23(35)16-5-9-18(10-6-16)30-22-21(28)15-29-25(33-22)32-19-11-7-17(8-12-19)24(36)37/h5-12,15,20H,13-14H2,1-4H3,(H,31,35)(H,36,37)(H2,29,30,32,33) |
| InChIKey | QFYZYAWMERCKSL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 155517892 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155517892?
The IUPAC name of CID 155517892 (CID 155517892) is not available.
What is the SMILES notation for CID 155517892?
The canonical SMILES for CID 155517892 is CC1(C)CC(NC(=O)c2ccc(Nc3nc(Nc4ccc(C(=O)O)cc4)ncc3Br)cc2)CC(C)(C)N1[O].
What is the InChIKey of CID 155517892?
The InChIKey is QFYZYAWMERCKSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30BrN6O4/c1-26(2)13-20(14-27(3,4)34(26)38)31-23(35)16-5-9-18(10-6-16)30-22-21(28)15-29-25(33-22)32-19-11-7-17(8-12-19)24(36)37/h5-12,15,20H,13-14H2,1-4H3,(H,31,35)(H,36,37)(H2,29,30,32,33).
What are the key properties of CID 155517892?
CID 155517892 has a molecular weight of 582.48 g/mol, XLogP of 5.52, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155517892 is sourced from PubChem (CID 155517892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).