About 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one
3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one (PubChem CID 155517907) has the molecular formula C15H15N5O2S
and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one.
Molecular Properties
| Compound Name | 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one |
| PubChem CID | 155517907 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one |
| SMILES | O=c1c2ncn(CCCCO)c2nc2[nH]c(-c3cccs3)cn12 |
| InChI | InChI=1S/C15H15N5O2S/c21-6-2-1-5-19-9-16-12-13(19)18-15-17-10(8-20(15)14(12)22)11-4-3-7-23-11/h3-4,7-9,21H,1-2,5-6H2,(H,17,18) |
| InChIKey | GGVSWNXELMQVBG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one?
The IUPAC name of 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one (CID 155517907) is 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one.
What is the SMILES notation for 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one?
The canonical SMILES for 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one is O=c1c2ncn(CCCCO)c2nc2[nH]c(-c3cccs3)cn12.
What is the InChIKey of 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one?
The InChIKey is GGVSWNXELMQVBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O2S/c21-6-2-1-5-19-9-16-12-13(19)18-15-17-10(8-20(15)14(12)22)11-4-3-7-23-11/h3-4,7-9,21H,1-2,5-6H2,(H,17,18).
What are the key properties of 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one?
3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one has a molecular weight of 329.39 g/mol, XLogP of 1.87, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxybutyl)-6-thiophen-2-yl-5H-imidazo[1,2-a]purin-9-one is sourced from PubChem (CID 155517907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).