C24H24Cl2N4O2S — CID 155517959
3,4-dichloro-N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide (PubChem CID 155517959) has the molecular formula C24H24Cl2N4O2S and a molecular weight of 503.46 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155517959 |
| Molecular Formula | C24H24Cl2N4O2S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 3,4-dichloro-N-[2-[3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propylamino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNCCCc1ccc(-c2cnc3[nH]ccc3c2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H24Cl2N4O2S/c25-22-8-7-21(15-23(22)26)33(31,32)30-13-12-27-10-1-2-17-3-5-18(6-4-17)20-14-19-9-11-28-24(19)29-16-20/h3-9,11,14-16,27,30H,1-2,10,12-13H2,(H,28,29) |
| InChIKey | PLZPWZFBCQPNLY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|