About 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide
4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide (PubChem CID 155517996) has the molecular formula C11H13N3O3S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide |
| PubChem CID | 155517996 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide |
| SMILES | CC1=NN(c2ccc(S(N)(=O)=O)cc2)C(=O)CC1 |
| InChI | InChI=1S/C11H13N3O3S/c1-8-2-7-11(15)14(13-8)9-3-5-10(6-4-9)18(12,16)17/h3-6H,2,7H2,1H3,(H2,12,16,17) |
| InChIKey | YBPHQXQYXLFKKW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide?
The IUPAC name of 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide (CID 155517996) is 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide.
What is the SMILES notation for 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide?
The canonical SMILES for 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide is CC1=NN(c2ccc(S(N)(=O)=O)cc2)C(=O)CC1.
What is the InChIKey of 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide?
The InChIKey is YBPHQXQYXLFKKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3S/c1-8-2-7-11(15)14(13-8)9-3-5-10(6-4-9)18(12,16)17/h3-6H,2,7H2,1H3,(H2,12,16,17).
What are the key properties of 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide?
4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide has a molecular weight of 267.31 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)benzenesulfonamide is sourced from PubChem (CID 155517996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).