C32H32ClN3O5S — CID 155518084
6-methoxy-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine chloride (PubChem CID 155518084) has the molecular formula C32H32ClN3O5S and a molecular weight of 606.14 g/mol. Its IUPAC name is 6-methoxy-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine chloride.
| Compound Name | 6-methoxy-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine chloride |
|---|---|
| PubChem CID | 155518084 |
| Molecular Formula | C32H32ClN3O5S |
| Molecular Weight | 606.14 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | 6-methoxy-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine chloride |
| SMILES | COc1ccc2nc(NCCCCCOc3c(OC)ccc4cc5[n+](cc34)CCc3cc4c(cc3-5)OCO4)sc2c1.[Cl-] |
| InChI | InChI=1S/C32H32N3O5S.ClH/c1-36-22-7-8-25-30(16-22)41-32(34-25)33-11-4-3-5-13-38-31-24-18-35-12-10-21-15-28-29(40-19-39-28)17-23(21)26(35)14-20(24)6-9-27(31)37-2;/h6-9,14-18H,3-5,10-13,19H2,1-2H3,(H,33,34);1H/q+1;/p-1 |
| InChIKey | SUTWACDINLNMBX-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|