C16H16N8O4S — CID 155518138
1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylurea (PubChem CID 155518138) has the molecular formula C16H16N8O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is 1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylurea.
| Compound Name | 1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylurea |
|---|---|
| PubChem CID | 155518138 |
| Molecular Formula | C16H16N8O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-[[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carbonyl]amino]-3-phenylurea |
| SMILES | Nc1nc(C(=O)NNC(=O)Nc2ccccc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16N8O4S/c17-15-20-13(14(25)21-22-16(26)19-10-4-2-1-3-5-10)23-24(15)11-6-8-12(9-7-11)29(18,27)28/h1-9H,(H,21,25)(H2,17,20,23)(H2,18,27,28)(H2,19,22,26) |
| InChIKey | CRMCREHLUPUQAV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 187.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|