C19H26O4 — CID 155518143
(E,5S)-5-hydroxy-8-[2-[(E,3R)-3-hydroxypent-1-enyl]phenyl]oct-6-enoic acid (PubChem CID 155518143) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (E,5S)-5-hydroxy-8-[2-[(E,3R)-3-hydroxypent-1-enyl]phenyl]oct-6-enoic acid.
| Compound Name | (E,5S)-5-hydroxy-8-[2-[(E,3R)-3-hydroxypent-1-enyl]phenyl]oct-6-enoic acid |
|---|---|
| PubChem CID | 155518143 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (E,5S)-5-hydroxy-8-[2-[(E,3R)-3-hydroxypent-1-enyl]phenyl]oct-6-enoic acid |
| SMILES | CC[C@@H](O)/C=C/c1ccccc1C/C=C/[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C19H26O4/c1-2-17(20)14-13-16-8-4-3-7-15(16)9-5-10-18(21)11-6-12-19(22)23/h3-5,7-8,10,13-14,17-18,20-21H,2,6,9,11-12H2,1H3,(H,22,23)/b10-5+,14-13+/t17-,18-/m1/s1 |
| InChIKey | RVZNRWKRAYYIDF-ALXSZMNFSA-N |
| XLogP | 3.19 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|