About 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid
1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 155518149) has the molecular formula C16H20N4O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid |
| PubChem CID | 155518149 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(CCO/N=C/c2c[nH]c3ncccc23)C1 |
| InChI | InChI=1S/C16H20N4O3/c21-16(22)12-3-2-6-20(11-12)7-8-23-19-10-13-9-18-15-14(13)4-1-5-17-15/h1,4-5,9-10,12H,2-3,6-8,11H2,(H,17,18)(H,21,22)/b19-10+ |
| InChIKey | HVEJDJHFZPPQCO-VXLYETTFSA-N |
| XLogP | 1.71 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid?
The IUPAC name of 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid (CID 155518149) is 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid?
The canonical SMILES for 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid is O=C(O)C1CCCN(CCO/N=C/c2c[nH]c3ncccc23)C1.
What is the InChIKey of 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid?
The InChIKey is HVEJDJHFZPPQCO-VXLYETTFSA-N. The full InChI is InChI=1S/C16H20N4O3/c21-16(22)12-3-2-6-20(11-12)7-8-23-19-10-13-9-18-15-14(13)4-1-5-17-15/h1,4-5,9-10,12H,2-3,6-8,11H2,(H,17,18)(H,21,22)/b19-10+.
What are the key properties of 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid?
1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid has a molecular weight of 316.36 g/mol, XLogP of 1.71, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(E)-1H-pyrrolo[2,3-b]pyridin-3-ylmethylideneamino]oxyethyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 155518149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).