C25H29N3O4 — CID 155518212
N-[(2S,3R)-3-hydroxy-1-(methylamino)-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide (PubChem CID 155518212) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(methylamino)-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(methylamino)-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 155518212 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(methylamino)-1-oxobutan-2-yl]-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]benzamide |
| SMILES | CNC(=O)[C@@H](NC(=O)c1ccc(C#Cc2ccc(CN3CCOCC3)cc2)cc1)[C@@H](C)O |
| InChI | InChI=1S/C25H29N3O4/c1-18(29)23(25(31)26-2)27-24(30)22-11-9-20(10-12-22)4-3-19-5-7-21(8-6-19)17-28-13-15-32-16-14-28/h5-12,18,23,29H,13-17H2,1-2H3,(H,26,31)(H,27,30)/t18-,23+/m1/s1 |
| InChIKey | HHDZHSAKQQVWBJ-JPYJTQIMSA-N |
| XLogP | 1.14 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|