C25H35N7O5 — CID 155518269
(3R,4R,5S)-4-acetamido-5-amino-N-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]ethyl]-3-pentan-3-yloxycyclohexene-1-carboxamide (PubChem CID 155518269) has the molecular formula C25H35N7O5 and a molecular weight of 513.60 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-amino-N-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]ethyl]-3-pentan-3-yloxycyclohexene-1-carboxamide.
| Compound Name | (3R,4R,5S)-4-acetamido-5-amino-N-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]ethyl]-3-pentan-3-yloxycyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 155518269 |
| Molecular Formula | C25H35N7O5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-amino-N-[2-[1-[(4-nitrophenyl)methyl]triazol-4-yl]ethyl]-3-pentan-3-yloxycyclohexene-1-carboxamide |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)NCCc2cn(Cc3ccc([N+](=O)[O-])cc3)nn2)C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C25H35N7O5/c1-4-21(5-2)37-23-13-18(12-22(26)24(23)28-16(3)33)25(34)27-11-10-19-15-31(30-29-19)14-17-6-8-20(9-7-17)32(35)36/h6-9,13,15,21-24H,4-5,10-12,14,26H2,1-3H3,(H,27,34)(H,28,33)/t22-,23+,24+/m0/s1 |
| InChIKey | IVORERVVPLPJMZ-RBZQAINGSA-N |
| XLogP | 1.63 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|