C21H28FN5O3S3 — CID 155518327
(5R,8S,11S)-11-[(Z)-1-fluoro-4-sulfanylbut-1-enyl]-5-methyl-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione (PubChem CID 155518327) has the molecular formula C21H28FN5O3S3 and a molecular weight of 513.69 g/mol. Its IUPAC name is (5R,8S,11S)-11-[(Z)-1-fluoro-4-sulfanylbut-1-enyl]-5-methyl-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione.
| Compound Name | (5R,8S,11S)-11-[(Z)-1-fluoro-4-sulfanylbut-1-enyl]-5-methyl-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
|---|---|
| PubChem CID | 155518327 |
| Molecular Formula | C21H28FN5O3S3 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (5R,8S,11S)-11-[(Z)-1-fluoro-4-sulfanylbut-1-enyl]-5-methyl-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@]2(C)CSC(=N2)c2csc(n2)CNC(=O)C[C@@H](/C(F)=C/CCS)NC1=O |
| InChI | InChI=1S/C21H28FN5O3S3/c1-11(2)17-18(29)25-13(12(22)5-4-6-31)7-15(28)23-8-16-24-14(9-32-16)19-27-21(3,10-33-19)20(30)26-17/h5,9,11,13,17,31H,4,6-8,10H2,1-3H3,(H,23,28)(H,25,29)(H,26,30)/b12-5-/t13-,17-,21-/m0/s1 |
| InChIKey | XRHLECJNJSLFEN-OUPKMXIISA-N |
| XLogP | 2.21 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|