C15H22O4 — CID 155518332
(2E,4S,5S)-4,5-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hepta-2,6-dienoic acid (PubChem CID 155518332) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2E,4S,5S)-4,5-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hepta-2,6-dienoic acid.
| Compound Name | (2E,4S,5S)-4,5-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hepta-2,6-dienoic acid |
|---|---|
| PubChem CID | 155518332 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2E,4S,5S)-4,5-dihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hepta-2,6-dienoic acid |
| SMILES | C=C([C@H]1CC=C(C)CC1)[C@H](O)[C@@H](O)/C=C(\C)C(=O)O |
| InChI | InChI=1S/C15H22O4/c1-9-4-6-12(7-5-9)11(3)14(17)13(16)8-10(2)15(18)19/h4,8,12-14,16-17H,3,5-7H2,1-2H3,(H,18,19)/b10-8+/t12-,13-,14-/m0/s1 |
| InChIKey | BMWFTTBVSXJUPE-OGCFBJAKSA-N |
| XLogP | 2.04 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|