C30H40N4O — CID 155518393
N-[[9-[3-(dimethylamino)propyl]-6-(4-methoxyphenyl)carbazol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 155518393) has the molecular formula C30H40N4O and a molecular weight of 472.68 g/mol. Its IUPAC name is N-[[9-[3-(dimethylamino)propyl]-6-(4-methoxyphenyl)carbazol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[9-[3-(dimethylamino)propyl]-6-(4-methoxyphenyl)carbazol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 155518393 |
| Molecular Formula | C30H40N4O |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | N-[[9-[3-(dimethylamino)propyl]-6-(4-methoxyphenyl)carbazol-3-yl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(-c2ccc3c(c2)c2cc(CNCCCN(C)C)ccc2n3CCCN(C)C)cc1 |
| InChI | InChI=1S/C30H40N4O/c1-32(2)17-6-16-31-22-23-8-14-29-27(20-23)28-21-25(24-9-12-26(35-5)13-10-24)11-15-30(28)34(29)19-7-18-33(3)4/h8-15,20-21,31H,6-7,16-19,22H2,1-5H3 |
| InChIKey | GYQMMXMAWOCHPI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|