About 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid
3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid (PubChem CID 155518513) has the molecular formula C18H13Cl2NO3
and a molecular weight of 362.21 g/mol. Its IUPAC name is 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid |
| PubChem CID | 155518513 |
| Molecular Formula | C18H13Cl2NO3 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1nc(-c2cc(Cl)cc(Cl)c2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H13Cl2NO3/c19-13-8-12(9-14(20)10-13)17-18(11-4-2-1-3-5-11)24-15(21-17)6-7-16(22)23/h1-5,8-10H,6-7H2,(H,22,23) |
| InChIKey | QVACAVHVLFVJTI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid?
The IUPAC name of 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid (CID 155518513) is 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid.
What is the SMILES notation for 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid?
The canonical SMILES for 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid is O=C(O)CCc1nc(-c2cc(Cl)cc(Cl)c2)c(-c2ccccc2)o1.
What is the InChIKey of 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid?
The InChIKey is QVACAVHVLFVJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2NO3/c19-13-8-12(9-14(20)10-13)17-18(11-4-2-1-3-5-11)24-15(21-17)6-7-16(22)23/h1-5,8-10H,6-7H2,(H,22,23).
What are the key properties of 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid?
3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid has a molecular weight of 362.21 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]propanoic acid is sourced from PubChem (CID 155518513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).