C27H22N4O4 — CID 155518636
(2Z)-2-[[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethylcarbamoyl]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide (PubChem CID 155518636) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is (2Z)-2-[[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethylcarbamoyl]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide.
| Compound Name | (2Z)-2-[[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethylcarbamoyl]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 155518636 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (2Z)-2-[[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethylcarbamoyl]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide |
| SMILES | Cc1ccc2nc(CCNC(=O)c3ccc(/C=C4\Oc5c(C(N)=O)cccc5C4=O)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H22N4O4/c1-15-5-10-20-21(13-15)31-23(30-20)11-12-29-27(34)17-8-6-16(7-9-17)14-22-24(32)18-3-2-4-19(26(28)33)25(18)35-22/h2-10,13-14H,11-12H2,1H3,(H2,28,33)(H,29,34)(H,30,31)/b22-14- |
| InChIKey | YNOAURUBJUTHDB-HMAPJEAMSA-N |
| XLogP | 3.56 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|