C18H22N4O3 — CID 155518640
2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 155518640) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155518640 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(N2CCN(c3nc4c(c(=O)[nH]3)COCC4)CC2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c1-24-14-4-2-13(3-5-14)21-7-9-22(10-8-21)18-19-16-6-11-25-12-15(16)17(23)20-18/h2-5H,6-12H2,1H3,(H,19,20,23) |
| InChIKey | LKXXRPOJTMCZTK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|