C16H23N3S — CID 155518652
(1R,4R)-1,7,7-trimethyl-N-(2-pyrimidin-2-ylsulfanylethyl)bicyclo[2.2.1]heptan-2-imine (PubChem CID 155518652) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is (1R,4R)-1,7,7-trimethyl-N-(2-pyrimidin-2-ylsulfanylethyl)bicyclo[2.2.1]heptan-2-imine.
| Compound Name | (1R,4R)-1,7,7-trimethyl-N-(2-pyrimidin-2-ylsulfanylethyl)bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 155518652 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (1R,4R)-1,7,7-trimethyl-N-(2-pyrimidin-2-ylsulfanylethyl)bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/CCSc1ncccn1)C2 |
| InChI | InChI=1S/C16H23N3S/c1-15(2)12-5-6-16(15,3)13(11-12)17-9-10-20-14-18-7-4-8-19-14/h4,7-8,12H,5-6,9-11H2,1-3H3/b17-13+/t12-,16+/m1/s1 |
| InChIKey | QSJLCFJDPSXANZ-BQRJLUARSA-N |
| XLogP | 3.86 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|