C22H12Cl2FNO3 — CID 155518654
4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]benzoic acid (PubChem CID 155518654) has the molecular formula C22H12Cl2FNO3 and a molecular weight of 428.25 g/mol. Its IUPAC name is 4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]benzoic acid.
| Compound Name | 4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 155518654 |
| Molecular Formula | C22H12Cl2FNO3 |
| Molecular Weight | 428.25 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-[3-(2,6-dichlorobenzoyl)-4-fluoroindol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2cc(C(=O)c3c(Cl)cccc3Cl)c3c(F)cccc32)cc1 |
| InChI | InChI=1S/C22H12Cl2FNO3/c23-15-3-1-4-16(24)20(15)21(27)14-11-26(18-6-2-5-17(25)19(14)18)13-9-7-12(8-10-13)22(28)29/h1-11H,(H,28,29) |
| InChIKey | VQSPTRMJQBBPEN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.25 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |