C29H40N4O3 — CID 155518784
(3S)-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]-3-(3-morpholin-4-ylphenyl)butanoate (PubChem CID 155518784) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is (3S)-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]-3-(3-morpholin-4-ylphenyl)butanoate.
| Compound Name | (3S)-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]-3-(3-morpholin-4-ylphenyl)butanoate |
|---|---|
| PubChem CID | 155518784 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | (3S)-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]-3-(3-morpholin-4-ylphenyl)butanoate |
| SMILES | C[N+]1(C[C@@H](CC(=O)[O-])c2cccc(N3CCOCC3)c2)CC[C@@H](CCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H40N4O3/c1-33(15-11-22(20-33)7-9-26-10-8-23-5-3-12-30-29(23)31-26)21-25(19-28(34)35)24-4-2-6-27(18-24)32-13-16-36-17-14-32/h2,4,6,8,10,18,22,25H,3,5,7,9,11-17,19-21H2,1H3,(H-,30,31,34,35)/t22-,25-,33?/m1/s1 |
| InChIKey | WEYZFBLZVFBVAR-QOWBJJBESA-N |
| XLogP | 2.60 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|